dihexyl hexanedioate


dihexyl adipate; dihexyl hexanedioate
Links:📏 NIST, 🕷 ChemSpider
CAS RN:[110-33-8]
Formula:C18H34O4; 314.47 g/mol
InChiKey:HHECSPXBQJHZAF-UHFFFAOYSA-N
SMILES:CCCCCCOC(=O)CCCCC(=O)OCCCCCC
Molecular structure of dihexyl hexanedioate
Melting point:-8 °C
Boiling point:345 °C

Isomers

bis(2-ethylbutyl) hexanedioate
Molecular structure of bis(2-ethylbutyl) hexanedioate
dibutyl decanedioate
Molecular structure of dibutyl decanedioate
diethyl tetradecandioate
Molecular structure of diethyl tetradecandioate
dihexyl hexanedioate
Molecular structure of dihexyl hexanedioate
1,2-ethanediol dicaprylate
Molecular structure of 1,2-ethanediol dicaprylate